C30H29FN4O2 — CID 176598919
N-[(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-6-methyl-4-[2-(1-methylpiperidin-4-yl)ethynyl]pyridine-2-carboxamide (PubChem CID 176598919) has the molecular formula C30H29FN4O2 and a molecular weight of 496.59 g/mol. Its IUPAC name is N-[(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-6-methyl-4-[2-(1-methylpiperidin-4-yl)ethynyl]pyridine-2-carboxamide.
| Compound Name | N-[(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-6-methyl-4-[2-(1-methylpiperidin-4-yl)ethynyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 176598919 |
| Molecular Formula | C30H29FN4O2 |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | N-[(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-6-methyl-4-[2-(1-methylpiperidin-4-yl)ethynyl]pyridine-2-carboxamide |
| SMILES | Cc1cc(C#CC2CCN(C)CC2)cc(C(=O)NC(c2cc3ccccc3[nH]2)c2cc(F)ccc2O)n1 |
| InChI | InChI=1S/C30H29FN4O2/c1-19-15-21(8-7-20-11-13-35(2)14-12-20)16-27(32-19)30(37)34-29(24-18-23(31)9-10-28(24)36)26-17-22-5-3-4-6-25(22)33-26/h3-6,9-10,15-18,20,29,33,36H,11-14H2,1-2H3,(H,34,37) |
| InChIKey | WERLRRQXNLMESQ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 81.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|