C27H24F2N2O3 — CID 176598930
N-[(5-fluoro-2-hydroxyphenyl)-(4-fluorophenyl)methyl]-6-methyl-4-[2-(oxan-4-yl)ethynyl]pyridine-2-carboxamide (PubChem CID 176598930) has the molecular formula C27H24F2N2O3 and a molecular weight of 462.50 g/mol. Its IUPAC name is N-[(5-fluoro-2-hydroxyphenyl)-(4-fluorophenyl)methyl]-6-methyl-4-[2-(oxan-4-yl)ethynyl]pyridine-2-carboxamide.
| Compound Name | N-[(5-fluoro-2-hydroxyphenyl)-(4-fluorophenyl)methyl]-6-methyl-4-[2-(oxan-4-yl)ethynyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 176598930 |
| Molecular Formula | C27H24F2N2O3 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | N-[(5-fluoro-2-hydroxyphenyl)-(4-fluorophenyl)methyl]-6-methyl-4-[2-(oxan-4-yl)ethynyl]pyridine-2-carboxamide |
| SMILES | Cc1cc(C#CC2CCOCC2)cc(C(=O)NC(c2ccc(F)cc2)c2cc(F)ccc2O)n1 |
| InChI | InChI=1S/C27H24F2N2O3/c1-17-14-19(3-2-18-10-12-34-13-11-18)15-24(30-17)27(33)31-26(20-4-6-21(28)7-5-20)23-16-22(29)8-9-25(23)32/h4-9,14-16,18,26,32H,10-13H2,1H3,(H,31,33) |
| InChIKey | LCAATZHYTPIXTL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|