C26H22F2N2O3 — CID 176599474
N-[(5-fluoro-2-hydroxyphenyl)-(4-fluorophenyl)methyl]-4-[2-[1-(hydroxymethyl)cyclopropyl]ethynyl]-6-methylpyridine-2-carboxamide (PubChem CID 176599474) has the molecular formula C26H22F2N2O3 and a molecular weight of 448.47 g/mol. Its IUPAC name is N-[(5-fluoro-2-hydroxyphenyl)-(4-fluorophenyl)methyl]-4-[2-[1-(hydroxymethyl)cyclopropyl]ethynyl]-6-methylpyridine-2-carboxamide.
| Compound Name | N-[(5-fluoro-2-hydroxyphenyl)-(4-fluorophenyl)methyl]-4-[2-[1-(hydroxymethyl)cyclopropyl]ethynyl]-6-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 176599474 |
| Molecular Formula | C26H22F2N2O3 |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | N-[(5-fluoro-2-hydroxyphenyl)-(4-fluorophenyl)methyl]-4-[2-[1-(hydroxymethyl)cyclopropyl]ethynyl]-6-methylpyridine-2-carboxamide |
| SMILES | Cc1cc(C#CC2(CO)CC2)cc(C(=O)NC(c2ccc(F)cc2)c2cc(F)ccc2O)n1 |
| InChI | InChI=1S/C26H22F2N2O3/c1-16-12-17(8-9-26(15-31)10-11-26)13-22(29-16)25(33)30-24(18-2-4-19(27)5-3-18)21-14-20(28)6-7-23(21)32/h2-7,12-14,24,31-32H,10-11,15H2,1H3,(H,30,33) |
| InChIKey | UJTARPZDZHLKFN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|