C29H29F2N3O2 — CID 176599728
4-[2-(1,4-dimethylpiperidin-4-yl)ethynyl]-N-[(5-fluoro-2-hydroxyphenyl)-(4-fluorophenyl)methyl]-6-methylpyridine-2-carboxamide (PubChem CID 176599728) has the molecular formula C29H29F2N3O2 and a molecular weight of 489.57 g/mol. Its IUPAC name is 4-[2-(1,4-dimethylpiperidin-4-yl)ethynyl]-N-[(5-fluoro-2-hydroxyphenyl)-(4-fluorophenyl)methyl]-6-methylpyridine-2-carboxamide.
| Compound Name | 4-[2-(1,4-dimethylpiperidin-4-yl)ethynyl]-N-[(5-fluoro-2-hydroxyphenyl)-(4-fluorophenyl)methyl]-6-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 176599728 |
| Molecular Formula | C29H29F2N3O2 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | 4-[2-(1,4-dimethylpiperidin-4-yl)ethynyl]-N-[(5-fluoro-2-hydroxyphenyl)-(4-fluorophenyl)methyl]-6-methylpyridine-2-carboxamide |
| SMILES | Cc1cc(C#CC2(C)CCN(C)CC2)cc(C(=O)NC(c2ccc(F)cc2)c2cc(F)ccc2O)n1 |
| InChI | InChI=1S/C29H29F2N3O2/c1-19-16-20(10-11-29(2)12-14-34(3)15-13-29)17-25(32-19)28(36)33-27(21-4-6-22(30)7-5-21)24-18-23(31)8-9-26(24)35/h4-9,16-18,27,35H,12-15H2,1-3H3,(H,33,36) |
| InChIKey | QBLNULGABJPNFU-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|