C28H22FN5O2 — CID 176599276
N-[(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-6-methyl-4-[2-(1-methylpyrazol-4-yl)ethynyl]pyridine-2-carboxamide (PubChem CID 176599276) has the molecular formula C28H22FN5O2 and a molecular weight of 479.52 g/mol. Its IUPAC name is N-[(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-6-methyl-4-[2-(1-methylpyrazol-4-yl)ethynyl]pyridine-2-carboxamide.
| Compound Name | N-[(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-6-methyl-4-[2-(1-methylpyrazol-4-yl)ethynyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 176599276 |
| Molecular Formula | C28H22FN5O2 |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | N-[(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-6-methyl-4-[2-(1-methylpyrazol-4-yl)ethynyl]pyridine-2-carboxamide |
| SMILES | Cc1cc(C#Cc2cnn(C)c2)cc(C(=O)NC(c2cc3ccccc3[nH]2)c2cc(F)ccc2O)n1 |
| InChI | InChI=1S/C28H22FN5O2/c1-17-11-18(7-8-19-15-30-34(2)16-19)12-25(31-17)28(36)33-27(22-14-21(29)9-10-26(22)35)24-13-20-5-3-4-6-23(20)32-24/h3-6,9-16,27,32,35H,1-2H3,(H,33,36) |
| InChIKey | XWQLSMYIDLEADG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|