C28H24FN3O3 — CID 176599694
N-[(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-6-methyl-4-[2-(oxolan-2-yl)ethynyl]pyridine-2-carboxamide (PubChem CID 176599694) has the molecular formula C28H24FN3O3 and a molecular weight of 469.52 g/mol. Its IUPAC name is N-[(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-6-methyl-4-[2-(oxolan-2-yl)ethynyl]pyridine-2-carboxamide.
| Compound Name | N-[(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-6-methyl-4-[2-(oxolan-2-yl)ethynyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 176599694 |
| Molecular Formula | C28H24FN3O3 |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | N-[(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-6-methyl-4-[2-(oxolan-2-yl)ethynyl]pyridine-2-carboxamide |
| SMILES | Cc1cc(C#CC2CCCO2)cc(C(=O)NC(c2cc3ccccc3[nH]2)c2cc(F)ccc2O)n1 |
| InChI | InChI=1S/C28H24FN3O3/c1-17-13-18(8-10-21-6-4-12-35-21)14-25(30-17)28(34)32-27(22-16-20(29)9-11-26(22)33)24-15-19-5-2-3-7-23(19)31-24/h2-3,5,7,9,11,13-16,21,27,31,33H,4,6,12H2,1H3,(H,32,34) |
| InChIKey | VUUFDGLSNABHNJ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|