C27H25FN2O3 — CID 176599410
N-[(5-fluoro-2-hydroxyphenyl)-(4-methylphenyl)methyl]-6-methyl-4-[2-[(3S)-oxolan-3-yl]ethynyl]pyridine-2-carboxamide (PubChem CID 176599410) has the molecular formula C27H25FN2O3 and a molecular weight of 444.51 g/mol. Its IUPAC name is N-[(5-fluoro-2-hydroxyphenyl)-(4-methylphenyl)methyl]-6-methyl-4-[2-[(3S)-oxolan-3-yl]ethynyl]pyridine-2-carboxamide.
| Compound Name | N-[(5-fluoro-2-hydroxyphenyl)-(4-methylphenyl)methyl]-6-methyl-4-[2-[(3S)-oxolan-3-yl]ethynyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 176599410 |
| Molecular Formula | C27H25FN2O3 |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | N-[(5-fluoro-2-hydroxyphenyl)-(4-methylphenyl)methyl]-6-methyl-4-[2-[(3S)-oxolan-3-yl]ethynyl]pyridine-2-carboxamide |
| SMILES | Cc1ccc(C(NC(=O)c2cc(C#C[C@@H]3CCOC3)cc(C)n2)c2cc(F)ccc2O)cc1 |
| InChI | InChI=1S/C27H25FN2O3/c1-17-3-7-21(8-4-17)26(23-15-22(28)9-10-25(23)31)30-27(32)24-14-20(13-18(2)29-24)6-5-19-11-12-33-16-19/h3-4,7-10,13-15,19,26,31H,11-12,16H2,1-2H3,(H,30,32)/t19-,26?/m1/s1 |
| InChIKey | WONKCQIELSVTDV-ICCFGIFFSA-N |
| XLogP | 4.45 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|