C27H23F2N3O2 — CID 176599343
N-[(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-4-(3-fluoro-3-methylbut-1-ynyl)-6-methylpyridine-2-carboxamide (PubChem CID 176599343) has the molecular formula C27H23F2N3O2 and a molecular weight of 459.50 g/mol. Its IUPAC name is N-[(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-4-(3-fluoro-3-methylbut-1-ynyl)-6-methylpyridine-2-carboxamide.
| Compound Name | N-[(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-4-(3-fluoro-3-methylbut-1-ynyl)-6-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 176599343 |
| Molecular Formula | C27H23F2N3O2 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | N-[(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-4-(3-fluoro-3-methylbut-1-ynyl)-6-methylpyridine-2-carboxamide |
| SMILES | Cc1cc(C#CC(C)(C)F)cc(C(=O)NC(c2cc3ccccc3[nH]2)c2cc(F)ccc2O)n1 |
| InChI | InChI=1S/C27H23F2N3O2/c1-16-12-17(10-11-27(2,3)29)13-23(30-16)26(34)32-25(20-15-19(28)8-9-24(20)33)22-14-18-6-4-5-7-21(18)31-22/h4-9,12-15,25,31,33H,1-3H3,(H,32,34) |
| InChIKey | DPUSKBAIJJHXBL-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|