C29H22F2N4O2 — CID 176598891
N-[(5-fluoro-2-hydroxyphenyl)-(3-fluoro-1H-indol-2-yl)methyl]-4-[2-[1-(isocyanomethyl)cyclopropyl]ethynyl]-6-methylpyridine-2-carboxamide (PubChem CID 176598891) has the molecular formula C29H22F2N4O2 and a molecular weight of 496.52 g/mol. Its IUPAC name is N-[(5-fluoro-2-hydroxyphenyl)-(3-fluoro-1H-indol-2-yl)methyl]-4-[2-[1-(isocyanomethyl)cyclopropyl]ethynyl]-6-methylpyridine-2-carboxamide.
| Compound Name | N-[(5-fluoro-2-hydroxyphenyl)-(3-fluoro-1H-indol-2-yl)methyl]-4-[2-[1-(isocyanomethyl)cyclopropyl]ethynyl]-6-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 176598891 |
| Molecular Formula | C29H22F2N4O2 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | N-[(5-fluoro-2-hydroxyphenyl)-(3-fluoro-1H-indol-2-yl)methyl]-4-[2-[1-(isocyanomethyl)cyclopropyl]ethynyl]-6-methylpyridine-2-carboxamide |
| SMILES | [C-]#[N+]CC1(C#Cc2cc(C)nc(C(=O)NC(c3cc(F)ccc3O)c3[nH]c4ccccc4c3F)c2)CC1 |
| InChI | InChI=1S/C29H22F2N4O2/c1-17-13-18(9-10-29(11-12-29)16-32-2)14-23(33-17)28(37)35-26(21-15-19(30)7-8-24(21)36)27-25(31)20-5-3-4-6-22(20)34-27/h3-8,13-15,26,34,36H,11-12,16H2,1H3,(H,35,37) |
| InChIKey | VFFFPKQSHIPDOD-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 82.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|