C20H17FN2O2 — CID 176599346
N-[(S)-(5-fluoro-2-hydroxyphenyl)-phenylmethyl]-6-methylpyridine-2-carboxamide (PubChem CID 176599346) has the molecular formula C20H17FN2O2 and a molecular weight of 336.37 g/mol. Its IUPAC name is N-[(S)-(5-fluoro-2-hydroxyphenyl)-phenylmethyl]-6-methylpyridine-2-carboxamide.
| Compound Name | N-[(S)-(5-fluoro-2-hydroxyphenyl)-phenylmethyl]-6-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 176599346 |
| Molecular Formula | C20H17FN2O2 |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | N-[(S)-(5-fluoro-2-hydroxyphenyl)-phenylmethyl]-6-methylpyridine-2-carboxamide |
| SMILES | Cc1cccc(C(=O)N[C@@H](c2ccccc2)c2cc(F)ccc2O)n1 |
| InChI | InChI=1S/C20H17FN2O2/c1-13-6-5-9-17(22-13)20(25)23-19(14-7-3-2-4-8-14)16-12-15(21)10-11-18(16)24/h2-12,19,24H,1H3,(H,23,25)/t19-/m0/s1 |
| InChIKey | OHJQGDVJDDWSKJ-IBGZPJMESA-N |
| XLogP | 3.75 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|