C20H15F3N2O2 — CID 176599765
N-[(3,4-difluorophenyl)-(5-fluoro-2-hydroxyphenyl)methyl]-4-methylpyridine-2-carboxamide (PubChem CID 176599765) has the molecular formula C20H15F3N2O2 and a molecular weight of 372.35 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)-(5-fluoro-2-hydroxyphenyl)methyl]-4-methylpyridine-2-carboxamide.
| Compound Name | N-[(3,4-difluorophenyl)-(5-fluoro-2-hydroxyphenyl)methyl]-4-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 176599765 |
| Molecular Formula | C20H15F3N2O2 |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | N-[(3,4-difluorophenyl)-(5-fluoro-2-hydroxyphenyl)methyl]-4-methylpyridine-2-carboxamide |
| SMILES | Cc1ccnc(C(=O)NC(c2ccc(F)c(F)c2)c2cc(F)ccc2O)c1 |
| InChI | InChI=1S/C20H15F3N2O2/c1-11-6-7-24-17(8-11)20(27)25-19(12-2-4-15(22)16(23)9-12)14-10-13(21)3-5-18(14)26/h2-10,19,26H,1H3,(H,25,27) |
| InChIKey | FUQIDPSNSOUQNL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|