C34H31FN4OS — CID 166509757
2-[(R)-1H-benzimidazol-2-yl-(5-fluoro-2-hydroxyphenyl)methyl]-6-[4-(1-methylpiperidin-4-yl)phenyl]-3H-isoindole-1-thione (PubChem CID 166509757) has the molecular formula C34H31FN4OS and a molecular weight of 562.71 g/mol. Its IUPAC name is 2-[(R)-1H-benzimidazol-2-yl-(5-fluoro-2-hydroxyphenyl)methyl]-6-[4-(1-methylpiperidin-4-yl)phenyl]-3H-isoindole-1-thione.
| Compound Name | 2-[(R)-1H-benzimidazol-2-yl-(5-fluoro-2-hydroxyphenyl)methyl]-6-[4-(1-methylpiperidin-4-yl)phenyl]-3H-isoindole-1-thione |
|---|---|
| PubChem CID | 166509757 |
| Molecular Formula | C34H31FN4OS |
| Molecular Weight | 562.71 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | 2-[(R)-1H-benzimidazol-2-yl-(5-fluoro-2-hydroxyphenyl)methyl]-6-[4-(1-methylpiperidin-4-yl)phenyl]-3H-isoindole-1-thione |
| SMILES | CN1CCC(c2ccc(-c3ccc4c(c3)C(=S)N([C@@H](c3nc5ccccc5[nH]3)c3cc(F)ccc3O)C4)cc2)CC1 |
| InChI | InChI=1S/C34H31FN4OS/c1-38-16-14-23(15-17-38)21-6-8-22(9-7-21)24-10-11-25-20-39(34(41)27(25)18-24)32(28-19-26(35)12-13-31(28)40)33-36-29-4-2-3-5-30(29)37-33/h2-13,18-19,23,32,40H,14-17,20H2,1H3,(H,36,37)/t32-/m1/s1 |
| InChIKey | ILTLJZCSWKAFBJ-JGCGQSQUSA-N |
| XLogP | 7.16 |
| TPSA | 55.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.71 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|