C34H29F2N5O2 — CID 166509749
3-[1H-benzimidazol-2-yl-(5-fluoro-2-hydroxyphenyl)methyl]-6-[3-fluoro-4-(1-methylpiperidin-4-yl)phenyl]quinazolin-4-one (PubChem CID 166509749) has the molecular formula C34H29F2N5O2 and a molecular weight of 577.64 g/mol. Its IUPAC name is 3-[1H-benzimidazol-2-yl-(5-fluoro-2-hydroxyphenyl)methyl]-6-[3-fluoro-4-(1-methylpiperidin-4-yl)phenyl]quinazolin-4-one.
| Compound Name | 3-[1H-benzimidazol-2-yl-(5-fluoro-2-hydroxyphenyl)methyl]-6-[3-fluoro-4-(1-methylpiperidin-4-yl)phenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 166509749 |
| Molecular Formula | C34H29F2N5O2 |
| Molecular Weight | 577.64 g/mol |
| Exact Mass | 577.23 |
| IUPAC Name | 3-[1H-benzimidazol-2-yl-(5-fluoro-2-hydroxyphenyl)methyl]-6-[3-fluoro-4-(1-methylpiperidin-4-yl)phenyl]quinazolin-4-one |
| SMILES | CN1CCC(c2ccc(-c3ccc4ncn(C(c5nc6ccccc6[nH]5)c5cc(F)ccc5O)c(=O)c4c3)cc2F)CC1 |
| InChI | InChI=1S/C34H29F2N5O2/c1-40-14-12-20(13-15-40)24-9-6-22(17-27(24)36)21-7-10-28-25(16-21)34(43)41(19-37-28)32(26-18-23(35)8-11-31(26)42)33-38-29-4-2-3-5-30(29)39-33/h2-11,16-20,32,42H,12-15H2,1H3,(H,38,39) |
| InChIKey | QWRAJUHLAJTGNS-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.64 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|