C35H30F2N4O2 — CID 166509768
2-[1H-benzimidazol-2-yl-(5-fluoro-2-hydroxyphenyl)methyl]-7-[3-fluoro-4-(1-methylpiperidin-4-yl)phenyl]isoquinolin-1-one (PubChem CID 166509768) has the molecular formula C35H30F2N4O2 and a molecular weight of 576.65 g/mol. Its IUPAC name is 2-[1H-benzimidazol-2-yl-(5-fluoro-2-hydroxyphenyl)methyl]-7-[3-fluoro-4-(1-methylpiperidin-4-yl)phenyl]isoquinolin-1-one.
| Compound Name | 2-[1H-benzimidazol-2-yl-(5-fluoro-2-hydroxyphenyl)methyl]-7-[3-fluoro-4-(1-methylpiperidin-4-yl)phenyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 166509768 |
| Molecular Formula | C35H30F2N4O2 |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 576.23 |
| IUPAC Name | 2-[1H-benzimidazol-2-yl-(5-fluoro-2-hydroxyphenyl)methyl]-7-[3-fluoro-4-(1-methylpiperidin-4-yl)phenyl]isoquinolin-1-one |
| SMILES | CN1CCC(c2ccc(-c3ccc4ccn(C(c5nc6ccccc6[nH]5)c5cc(F)ccc5O)c(=O)c4c3)cc2F)CC1 |
| InChI | InChI=1S/C35H30F2N4O2/c1-40-15-12-22(13-16-40)26-10-8-24(19-29(26)37)23-7-6-21-14-17-41(35(43)27(21)18-23)33(28-20-25(36)9-11-32(28)42)34-38-30-4-2-3-5-31(30)39-34/h2-11,14,17-20,22,33,42H,12-13,15-16H2,1H3,(H,38,39) |
| InChIKey | MFZSXFSSDCVHAO-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|