C25H17FN6O2S — CID 176598950
5-[2-(6-amino-3-pyridinyl)ethynyl]-N-[1H-benzimidazol-2-yl-(5-fluoro-2-hydroxyphenyl)methyl]-1,3-thiazole-2-carboxamide (PubChem CID 176598950) has the molecular formula C25H17FN6O2S and a molecular weight of 484.52 g/mol. Its IUPAC name is 5-[2-(6-amino-3-pyridinyl)ethynyl]-N-[1H-benzimidazol-2-yl-(5-fluoro-2-hydroxyphenyl)methyl]-1,3-thiazole-2-carboxamide.
| Compound Name | 5-[2-(6-amino-3-pyridinyl)ethynyl]-N-[1H-benzimidazol-2-yl-(5-fluoro-2-hydroxyphenyl)methyl]-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 176598950 |
| Molecular Formula | C25H17FN6O2S |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | 5-[2-(6-amino-3-pyridinyl)ethynyl]-N-[1H-benzimidazol-2-yl-(5-fluoro-2-hydroxyphenyl)methyl]-1,3-thiazole-2-carboxamide |
| SMILES | Nc1ccc(C#Cc2cnc(C(=O)NC(c3nc4ccccc4[nH]3)c3cc(F)ccc3O)s2)cn1 |
| InChI | InChI=1S/C25H17FN6O2S/c26-15-7-9-20(33)17(11-15)22(23-30-18-3-1-2-4-19(18)31-23)32-24(34)25-29-13-16(35-25)8-5-14-6-10-21(27)28-12-14/h1-4,6-7,9-13,22,33H,(H2,27,28)(H,30,31)(H,32,34) |
| InChIKey | JXKPVBJJFGVUDR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 129.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|