C26H19ClFN5O2 — CID 176599401
4-[2-(6-amino-3-pyridinyl)ethynyl]-N-[(5-chloro-2-pyridinyl)-(5-fluoro-2-hydroxyphenyl)methyl]-6-methylpyridine-2-carboxamide (PubChem CID 176599401) has the molecular formula C26H19ClFN5O2 and a molecular weight of 487.92 g/mol. Its IUPAC name is 4-[2-(6-amino-3-pyridinyl)ethynyl]-N-[(5-chloro-2-pyridinyl)-(5-fluoro-2-hydroxyphenyl)methyl]-6-methylpyridine-2-carboxamide.
| Compound Name | 4-[2-(6-amino-3-pyridinyl)ethynyl]-N-[(5-chloro-2-pyridinyl)-(5-fluoro-2-hydroxyphenyl)methyl]-6-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 176599401 |
| Molecular Formula | C26H19ClFN5O2 |
| Molecular Weight | 487.92 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 4-[2-(6-amino-3-pyridinyl)ethynyl]-N-[(5-chloro-2-pyridinyl)-(5-fluoro-2-hydroxyphenyl)methyl]-6-methylpyridine-2-carboxamide |
| SMILES | Cc1cc(C#Cc2ccc(N)nc2)cc(C(=O)NC(c2ccc(Cl)cn2)c2cc(F)ccc2O)n1 |
| InChI | InChI=1S/C26H19ClFN5O2/c1-15-10-17(3-2-16-4-9-24(29)31-13-16)11-22(32-15)26(35)33-25(21-7-5-18(27)14-30-21)20-12-19(28)6-8-23(20)34/h4-14,25,34H,1H3,(H2,29,31)(H,33,35) |
| InChIKey | OJDFKDSVWZLBQV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 114.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.92 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|