C28H23FN4O3 — CID 176599136
N-[(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-6-(3-methoxyprop-1-ynyl)-1-methylindazole-3-carboxamide (PubChem CID 176599136) has the molecular formula C28H23FN4O3 and a molecular weight of 482.52 g/mol. Its IUPAC name is N-[(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-6-(3-methoxyprop-1-ynyl)-1-methylindazole-3-carboxamide.
| Compound Name | N-[(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-6-(3-methoxyprop-1-ynyl)-1-methylindazole-3-carboxamide |
|---|---|
| PubChem CID | 176599136 |
| Molecular Formula | C28H23FN4O3 |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | N-[(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-6-(3-methoxyprop-1-ynyl)-1-methylindazole-3-carboxamide |
| SMILES | COCC#Cc1ccc2c(C(=O)NC(c3cc4ccccc4[nH]3)c3cc(F)ccc3O)nn(C)c2c1 |
| InChI | InChI=1S/C28H23FN4O3/c1-33-24-14-17(6-5-13-36-2)9-11-20(24)27(32-33)28(35)31-26(21-16-19(29)10-12-25(21)34)23-15-18-7-3-4-8-22(18)30-23/h3-4,7-12,14-16,26,30,34H,13H2,1-2H3,(H,31,35) |
| InChIKey | YNTCTAXKFFLVMK-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 92.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|