C26H22FN3O3 — CID 176599167
N-[(5-fluoro-2-hydroxyphenyl)-(4-methylphenyl)methyl]-6-(3-hydroxyprop-1-ynyl)-1-methylindazole-3-carboxamide (PubChem CID 176599167) has the molecular formula C26H22FN3O3 and a molecular weight of 443.48 g/mol. Its IUPAC name is N-[(5-fluoro-2-hydroxyphenyl)-(4-methylphenyl)methyl]-6-(3-hydroxyprop-1-ynyl)-1-methylindazole-3-carboxamide.
| Compound Name | N-[(5-fluoro-2-hydroxyphenyl)-(4-methylphenyl)methyl]-6-(3-hydroxyprop-1-ynyl)-1-methylindazole-3-carboxamide |
|---|---|
| PubChem CID | 176599167 |
| Molecular Formula | C26H22FN3O3 |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | N-[(5-fluoro-2-hydroxyphenyl)-(4-methylphenyl)methyl]-6-(3-hydroxyprop-1-ynyl)-1-methylindazole-3-carboxamide |
| SMILES | Cc1ccc(C(NC(=O)c2nn(C)c3cc(C#CCO)ccc23)c2cc(F)ccc2O)cc1 |
| InChI | InChI=1S/C26H22FN3O3/c1-16-5-8-18(9-6-16)24(21-15-19(27)10-12-23(21)32)28-26(33)25-20-11-7-17(4-3-13-31)14-22(20)30(2)29-25/h5-12,14-15,24,31-32H,13H2,1-2H3,(H,28,33) |
| InChIKey | ODRFEXAVVCRYPO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|