C16H13BrFNO5S — CID 166885530
2-(2-bromo-4-oxo-6H-thieno[2,3-c]pyrrol-5-yl)-2-[5-fluoro-2-(methoxymethoxy)phenyl]acetic acid (PubChem CID 166885530) has the molecular formula C16H13BrFNO5S and a molecular weight of 430.25 g/mol. Its IUPAC name is 2-(2-bromo-4-oxo-6H-thieno[2,3-c]pyrrol-5-yl)-2-[5-fluoro-2-(methoxymethoxy)phenyl]acetic acid.
| Compound Name | 2-(2-bromo-4-oxo-6H-thieno[2,3-c]pyrrol-5-yl)-2-[5-fluoro-2-(methoxymethoxy)phenyl]acetic acid |
|---|---|
| PubChem CID | 166885530 |
| Molecular Formula | C16H13BrFNO5S |
| Molecular Weight | 430.25 g/mol |
| Exact Mass | 428.97 |
| IUPAC Name | 2-(2-bromo-4-oxo-6H-thieno[2,3-c]pyrrol-5-yl)-2-[5-fluoro-2-(methoxymethoxy)phenyl]acetic acid |
| SMILES | COCOc1ccc(F)cc1C(C(=O)O)N1Cc2sc(Br)cc2C1=O |
| InChI | InChI=1S/C16H13BrFNO5S/c1-23-7-24-11-3-2-8(18)4-9(11)14(16(21)22)19-6-12-10(15(19)20)5-13(17)25-12/h2-5,14H,6-7H2,1H3,(H,21,22) |
| InChIKey | UFIFDVGDJOOEGV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.25 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|