C27H29FN2O3S — CID 142390132
2-[4-[(Z)-but-2-en-2-yl]-3-ethenyl-5-oxo-2H-pyrrol-1-yl]-2-(5-fluoro-2-phenylmethoxyphenyl)ethanethioic S-acid;ethenamine (PubChem CID 142390132) has the molecular formula C27H29FN2O3S and a molecular weight of 480.61 g/mol. Its IUPAC name is 2-[4-[(Z)-but-2-en-2-yl]-3-ethenyl-5-oxo-2H-pyrrol-1-yl]-2-(5-fluoro-2-phenylmethoxyphenyl)ethanethioic S-acid;ethenamine.
| Compound Name | 2-[4-[(Z)-but-2-en-2-yl]-3-ethenyl-5-oxo-2H-pyrrol-1-yl]-2-(5-fluoro-2-phenylmethoxyphenyl)ethanethioic S-acid;ethenamine |
|---|---|
| PubChem CID | 142390132 |
| Molecular Formula | C27H29FN2O3S |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | 2-[4-[(Z)-but-2-en-2-yl]-3-ethenyl-5-oxo-2H-pyrrol-1-yl]-2-(5-fluoro-2-phenylmethoxyphenyl)ethanethioic S-acid;ethenamine |
| SMILES | C=CC1=C(/C(C)=C\C)C(=O)N(C(C(=O)S)c2cc(F)ccc2OCc2ccccc2)C1.C=CN |
| InChI | InChI=1S/C25H24FNO3S.C2H5N/c1-4-16(3)22-18(5-2)14-27(24(22)28)23(25(29)31)20-13-19(26)11-12-21(20)30-15-17-9-7-6-8-10-17;1-2-3/h4-13,23H,2,14-15H2,1,3H3,(H,29,31);2H,1,3H2/b16-4-; |
| InChIKey | RFUIKMSXJFQMDH-DQEXCLQCSA-N |
| XLogP | 5.28 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|