C35H48F2O6 — CID 160809883
acetic acid;5-fluoro-2-[(1S)-1-hydroxyheptyl]phenol;(1S)-1-(4-fluoro-2-phenylmethoxyphenyl)heptan-1-ol (PubChem CID 160809883) has the molecular formula C35H48F2O6 and a molecular weight of 602.76 g/mol. Its IUPAC name is acetic acid;5-fluoro-2-[(1S)-1-hydroxyheptyl]phenol;(1S)-1-(4-fluoro-2-phenylmethoxyphenyl)heptan-1-ol.
| Compound Name | acetic acid;5-fluoro-2-[(1S)-1-hydroxyheptyl]phenol;(1S)-1-(4-fluoro-2-phenylmethoxyphenyl)heptan-1-ol |
|---|---|
| PubChem CID | 160809883 |
| Molecular Formula | C35H48F2O6 |
| Molecular Weight | 602.76 g/mol |
| Exact Mass | 602.34 |
| IUPAC Name | acetic acid;5-fluoro-2-[(1S)-1-hydroxyheptyl]phenol;(1S)-1-(4-fluoro-2-phenylmethoxyphenyl)heptan-1-ol |
| SMILES | CC(=O)O.CCCCCC[C@H](O)c1ccc(F)cc1O.CCCCCC[C@H](O)c1ccc(F)cc1OCc1ccccc1 |
| InChI | InChI=1S/C20H25FO2.C13H19FO2.C2H4O2/c1-2-3-4-8-11-19(22)18-13-12-17(21)14-20(18)23-15-16-9-6-5-7-10-16;1-2-3-4-5-6-12(15)11-8-7-10(14)9-13(11)16;1-2(3)4/h5-7,9-10,12-14,19,22H,2-4,8,11,15H2,1H3;7-9,12,15-16H,2-6H2,1H3;1H3,(H,3,4)/t19-;12-;/m00./s1 |
| InChIKey | VGBRLGQPJXJUEA-XEMAHLBNSA-N |
| XLogP | 9.03 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.76 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|