C18H15BrFNO4 — CID 175748452
(2R)-2-(5-bromo-4-methyl-3-oxo-1H-isoindol-2-yl)-2-(5-fluoro-2-methoxyphenyl)acetic acid (PubChem CID 175748452) has the molecular formula C18H15BrFNO4 and a molecular weight of 408.22 g/mol. Its IUPAC name is (2R)-2-(5-bromo-4-methyl-3-oxo-1H-isoindol-2-yl)-2-(5-fluoro-2-methoxyphenyl)acetic acid.
| Compound Name | (2R)-2-(5-bromo-4-methyl-3-oxo-1H-isoindol-2-yl)-2-(5-fluoro-2-methoxyphenyl)acetic acid |
|---|---|
| PubChem CID | 175748452 |
| Molecular Formula | C18H15BrFNO4 |
| Molecular Weight | 408.22 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | (2R)-2-(5-bromo-4-methyl-3-oxo-1H-isoindol-2-yl)-2-(5-fluoro-2-methoxyphenyl)acetic acid |
| SMILES | COc1ccc(F)cc1[C@H](C(=O)O)N1Cc2ccc(Br)c(C)c2C1=O |
| InChI | InChI=1S/C18H15BrFNO4/c1-9-13(19)5-3-10-8-21(17(22)15(9)10)16(18(23)24)12-7-11(20)4-6-14(12)25-2/h3-7,16H,8H2,1-2H3,(H,23,24)/t16-/m1/s1 |
| InChIKey | UUBGTNASIIXJSW-MRXNPFEDSA-N |
| XLogP | 3.69 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.22 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |