C19H17BrFNO4 — CID 153408850
methyl 2-(5-bromo-4-methyl-3-oxo-1H-isoindol-2-yl)-2-(5-fluoro-2-methoxyphenyl)acetate (PubChem CID 153408850) has the molecular formula C19H17BrFNO4 and a molecular weight of 422.25 g/mol. Its IUPAC name is methyl 2-(5-bromo-4-methyl-3-oxo-1H-isoindol-2-yl)-2-(5-fluoro-2-methoxyphenyl)acetate.
| Compound Name | methyl 2-(5-bromo-4-methyl-3-oxo-1H-isoindol-2-yl)-2-(5-fluoro-2-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 153408850 |
| Molecular Formula | C19H17BrFNO4 |
| Molecular Weight | 422.25 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | methyl 2-(5-bromo-4-methyl-3-oxo-1H-isoindol-2-yl)-2-(5-fluoro-2-methoxyphenyl)acetate |
| SMILES | COC(=O)C(c1cc(F)ccc1OC)N1Cc2ccc(Br)c(C)c2C1=O |
| InChI | InChI=1S/C19H17BrFNO4/c1-10-14(20)6-4-11-9-22(18(23)16(10)11)17(19(24)26-3)13-8-12(21)5-7-15(13)25-2/h4-8,17H,9H2,1-3H3 |
| InChIKey | BGZOQTNRJYTUNR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.25 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |