C25H33N3O2 — CID 166912061
tert-butyl N-[2-[1-(2-methylpropyl)-6-pyridin-4-ylindol-3-yl]propyl]carbamate (PubChem CID 166912061) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is tert-butyl N-[2-[1-(2-methylpropyl)-6-pyridin-4-ylindol-3-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[2-[1-(2-methylpropyl)-6-pyridin-4-ylindol-3-yl]propyl]carbamate |
|---|---|
| PubChem CID | 166912061 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | tert-butyl N-[2-[1-(2-methylpropyl)-6-pyridin-4-ylindol-3-yl]propyl]carbamate |
| SMILES | CC(C)Cn1cc(C(C)CNC(=O)OC(C)(C)C)c2ccc(-c3ccncc3)cc21 |
| InChI | InChI=1S/C25H33N3O2/c1-17(2)15-28-16-22(18(3)14-27-24(29)30-25(4,5)6)21-8-7-20(13-23(21)28)19-9-11-26-12-10-19/h7-13,16-18H,14-15H2,1-6H3,(H,27,29) |
| InChIKey | UUHMOGZARZJHJV-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |