C20H25N3 — CID 166912236
2-[3-(2,2-dimethylpropyl)-5-pyridin-3-ylindol-1-yl]ethanamine (PubChem CID 166912236) has the molecular formula C20H25N3 and a molecular weight of 307.44 g/mol. Its IUPAC name is 2-[3-(2,2-dimethylpropyl)-5-pyridin-3-ylindol-1-yl]ethanamine.
| Compound Name | 2-[3-(2,2-dimethylpropyl)-5-pyridin-3-ylindol-1-yl]ethanamine |
|---|---|
| PubChem CID | 166912236 |
| Molecular Formula | C20H25N3 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | 2-[3-(2,2-dimethylpropyl)-5-pyridin-3-ylindol-1-yl]ethanamine |
| SMILES | CC(C)(C)Cc1cn(CCN)c2ccc(-c3cccnc3)cc12 |
| InChI | InChI=1S/C20H25N3/c1-20(2,3)12-17-14-23(10-8-21)19-7-6-15(11-18(17)19)16-5-4-9-22-13-16/h4-7,9,11,13-14H,8,10,12,21H2,1-3H3 |
| InChIKey | NZKNXBATIFGVFY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |