C34H48N6O2 — CID 166912609
(9S)-9-[[hydroxy-[(2S)-6-methyl-6-azaspiro[2.5]octan-2-yl]methyl]amino]-9-[5-(2-pyrrolidin-1-ylquinolin-6-yl)-1H-imidazol-2-yl]nonan-3-one (PubChem CID 166912609) has the molecular formula C34H48N6O2 and a molecular weight of 572.80 g/mol. Its IUPAC name is (9S)-9-[[hydroxy-[(2S)-6-methyl-6-azaspiro[2.5]octan-2-yl]methyl]amino]-9-[5-(2-pyrrolidin-1-ylquinolin-6-yl)-1H-imidazol-2-yl]nonan-3-one.
| Compound Name | (9S)-9-[[hydroxy-[(2S)-6-methyl-6-azaspiro[2.5]octan-2-yl]methyl]amino]-9-[5-(2-pyrrolidin-1-ylquinolin-6-yl)-1H-imidazol-2-yl]nonan-3-one |
|---|---|
| PubChem CID | 166912609 |
| Molecular Formula | C34H48N6O2 |
| Molecular Weight | 572.80 g/mol |
| Exact Mass | 572.38 |
| IUPAC Name | (9S)-9-[[hydroxy-[(2S)-6-methyl-6-azaspiro[2.5]octan-2-yl]methyl]amino]-9-[5-(2-pyrrolidin-1-ylquinolin-6-yl)-1H-imidazol-2-yl]nonan-3-one |
| SMILES | CCC(=O)CCCCC[C@H](NC(O)[C@H]1CC12CCN(C)CC2)c1ncc(-c2ccc3nc(N4CCCC4)ccc3c2)[nH]1 |
| InChI | InChI=1S/C34H48N6O2/c1-3-26(41)9-5-4-6-10-29(38-33(42)27-22-34(27)15-19-39(2)20-16-34)32-35-23-30(37-32)25-11-13-28-24(21-25)12-14-31(36-28)40-17-7-8-18-40/h11-14,21,23,27,29,33,38,42H,3-10,15-20,22H2,1-2H3,(H,35,37)/t27-,29+,33?/m1/s1 |
| InChIKey | ZFSRRPGKJBQFNC-SZWYDYHCSA-N |
| XLogP | 5.84 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.80 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|