C27H20F6IN5O4 — CID 166912896
N-[3-[3-cyclopropyl-5-(2-fluoro-4-iodoanilino)-6,8-dimethyl-2,4,7-trioxopyrido[4,3-d]pyrimidin-1-yl]phenyl]-2,2,3,3,3-pentafluoropropanamide (PubChem CID 166912896) has the molecular formula C27H20F6IN5O4 and a molecular weight of 719.38 g/mol. Its IUPAC name is N-[3-[3-cyclopropyl-5-(2-fluoro-4-iodoanilino)-6,8-dimethyl-2,4,7-trioxopyrido[4,3-d]pyrimidin-1-yl]phenyl]-2,2,3,3,3-pentafluoropropanamide.
| Compound Name | N-[3-[3-cyclopropyl-5-(2-fluoro-4-iodoanilino)-6,8-dimethyl-2,4,7-trioxopyrido[4,3-d]pyrimidin-1-yl]phenyl]-2,2,3,3,3-pentafluoropropanamide |
|---|---|
| PubChem CID | 166912896 |
| Molecular Formula | C27H20F6IN5O4 |
| Molecular Weight | 719.38 g/mol |
| Exact Mass | 719.05 |
| IUPAC Name | N-[3-[3-cyclopropyl-5-(2-fluoro-4-iodoanilino)-6,8-dimethyl-2,4,7-trioxopyrido[4,3-d]pyrimidin-1-yl]phenyl]-2,2,3,3,3-pentafluoropropanamide |
| SMILES | Cc1c(=O)n(C)c(Nc2ccc(I)cc2F)c2c(=O)n(C3CC3)c(=O)n(-c3cccc(NC(=O)C(F)(F)C(F)(F)F)c3)c12 |
| InChI | InChI=1S/C27H20F6IN5O4/c1-12-20-19(21(37(2)22(12)40)36-18-9-6-13(34)10-17(18)28)23(41)39(15-7-8-15)25(43)38(20)16-5-3-4-14(11-16)35-24(42)26(29,30)27(31,32)33/h3-6,9-11,15,36H,7-8H2,1-2H3,(H,35,42) |
| InChIKey | WJJDASRCAAHLCU-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.38 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|