C26H24FIN6O3S — CID 170396309
2-amino-N-[3-[3-cyclopropyl-5-(2-fluoro-4-iodoanilino)-6,8-dimethyl-2,4,7-trioxopyrido[4,3-d]pyrimidin-1-yl]phenyl]ethanethioamide (PubChem CID 170396309) has the molecular formula C26H24FIN6O3S and a molecular weight of 646.49 g/mol. Its IUPAC name is 2-amino-N-[3-[3-cyclopropyl-5-(2-fluoro-4-iodoanilino)-6,8-dimethyl-2,4,7-trioxopyrido[4,3-d]pyrimidin-1-yl]phenyl]ethanethioamide.
| Compound Name | 2-amino-N-[3-[3-cyclopropyl-5-(2-fluoro-4-iodoanilino)-6,8-dimethyl-2,4,7-trioxopyrido[4,3-d]pyrimidin-1-yl]phenyl]ethanethioamide |
|---|---|
| PubChem CID | 170396309 |
| Molecular Formula | C26H24FIN6O3S |
| Molecular Weight | 646.49 g/mol |
| Exact Mass | 646.07 |
| IUPAC Name | 2-amino-N-[3-[3-cyclopropyl-5-(2-fluoro-4-iodoanilino)-6,8-dimethyl-2,4,7-trioxopyrido[4,3-d]pyrimidin-1-yl]phenyl]ethanethioamide |
| SMILES | Cc1c(=O)n(C)c(Nc2ccc(I)cc2F)c2c(=O)n(C3CC3)c(=O)n(-c3cccc(NC(=S)CN)c3)c12 |
| InChI | InChI=1S/C26H24FIN6O3S/c1-13-22-21(23(32(2)24(13)35)31-19-9-6-14(28)10-18(19)27)25(36)34(16-7-8-16)26(37)33(22)17-5-3-4-15(11-17)30-20(38)12-29/h3-6,9-11,16,31H,7-8,12,29H2,1-2H3,(H,30,38) |
| InChIKey | CUJDWHBXSMLDLY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|