C24H21FIN5O3S — CID 170396251
N-[3-[5-(2-fluoro-4-iodoanilino)-3,6,8-trimethyl-2,4,7-trioxopyrido[4,3-d]pyrimidin-1-yl]phenyl]ethanethioamide (PubChem CID 170396251) has the molecular formula C24H21FIN5O3S and a molecular weight of 605.43 g/mol. Its IUPAC name is N-[3-[5-(2-fluoro-4-iodoanilino)-3,6,8-trimethyl-2,4,7-trioxopyrido[4,3-d]pyrimidin-1-yl]phenyl]ethanethioamide.
| Compound Name | N-[3-[5-(2-fluoro-4-iodoanilino)-3,6,8-trimethyl-2,4,7-trioxopyrido[4,3-d]pyrimidin-1-yl]phenyl]ethanethioamide |
|---|---|
| PubChem CID | 170396251 |
| Molecular Formula | C24H21FIN5O3S |
| Molecular Weight | 605.43 g/mol |
| Exact Mass | 605.04 |
| IUPAC Name | N-[3-[5-(2-fluoro-4-iodoanilino)-3,6,8-trimethyl-2,4,7-trioxopyrido[4,3-d]pyrimidin-1-yl]phenyl]ethanethioamide |
| SMILES | CC(=S)Nc1cccc(-n2c(=O)n(C)c(=O)c3c(Nc4ccc(I)cc4F)n(C)c(=O)c(C)c32)c1 |
| InChI | InChI=1S/C24H21FIN5O3S/c1-12-20-19(21(29(3)22(12)32)28-18-9-8-14(26)10-17(18)25)23(33)30(4)24(34)31(20)16-7-5-6-15(11-16)27-13(2)35/h5-11,28H,1-4H3,(H,27,35) |
| InChIKey | NKSFIQQAFOYCTI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|