C25H24N2O3 — CID 166913661
2-[2-(3-methoxybenzoyl)prop-2-enyl]-4-[(1E,3Z)-1-(methylideneamino)penta-1,3-dien-2-yl]-3H-isoindol-1-one (PubChem CID 166913661) has the molecular formula C25H24N2O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is 2-[2-(3-methoxybenzoyl)prop-2-enyl]-4-[(1E,3Z)-1-(methylideneamino)penta-1,3-dien-2-yl]-3H-isoindol-1-one.
| Compound Name | 2-[2-(3-methoxybenzoyl)prop-2-enyl]-4-[(1E,3Z)-1-(methylideneamino)penta-1,3-dien-2-yl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 166913661 |
| Molecular Formula | C25H24N2O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 2-[2-(3-methoxybenzoyl)prop-2-enyl]-4-[(1E,3Z)-1-(methylideneamino)penta-1,3-dien-2-yl]-3H-isoindol-1-one |
| SMILES | C=N/C=C(\C=C/C)c1cccc2c1CN(CC(=C)C(=O)c1cccc(OC)c1)C2=O |
| InChI | InChI=1S/C25H24N2O3/c1-5-8-19(14-26-3)21-11-7-12-22-23(21)16-27(25(22)29)15-17(2)24(28)18-9-6-10-20(13-18)30-4/h5-14H,2-3,15-16H2,1,4H3/b8-5-,19-14+ |
| InChIKey | XNSBGSJBIMXETE-CUEXEPPRSA-N |
| XLogP | 4.71 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|