C27H26FN3O — CID 166917310
1-[3-benzyl-3-[1-(4-fluorophenyl)-6-methylindazol-5-yl]pyrrolidin-1-yl]ethanone (PubChem CID 166917310) has the molecular formula C27H26FN3O and a molecular weight of 427.52 g/mol. Its IUPAC name is 1-[3-benzyl-3-[1-(4-fluorophenyl)-6-methylindazol-5-yl]pyrrolidin-1-yl]ethanone.
| Compound Name | 1-[3-benzyl-3-[1-(4-fluorophenyl)-6-methylindazol-5-yl]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 166917310 |
| Molecular Formula | C27H26FN3O |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 1-[3-benzyl-3-[1-(4-fluorophenyl)-6-methylindazol-5-yl]pyrrolidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(Cc2ccccc2)(c2cc3cnn(-c4ccc(F)cc4)c3cc2C)C1 |
| InChI | InChI=1S/C27H26FN3O/c1-19-14-26-22(17-29-31(26)24-10-8-23(28)9-11-24)15-25(19)27(12-13-30(18-27)20(2)32)16-21-6-4-3-5-7-21/h3-11,14-15,17H,12-13,16,18H2,1-2H3 |
| InChIKey | VIAVRKVNHGPEEO-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |