C32H43ClN6O6 — CID 166918211
tert-butyl N-[2-[2-[2-[[(2R)-2-[(4S)-6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]-1-hydroxypropyl]amino]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 166918211) has the molecular formula C32H43ClN6O6 and a molecular weight of 643.19 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[[(2R)-2-[(4S)-6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]-1-hydroxypropyl]amino]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-[[(2R)-2-[(4S)-6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]-1-hydroxypropyl]amino]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 166918211 |
| Molecular Formula | C32H43ClN6O6 |
| Molecular Weight | 643.19 g/mol |
| Exact Mass | 642.29 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[[(2R)-2-[(4S)-6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]-1-hydroxypropyl]amino]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | COc1ccc2c(c1)C(c1ccc(Cl)cc1)=N[C@@H]([C@@H](C)C(O)NCCOCCOCCNC(=O)OC(C)(C)C)c1nnc(C)n1-2 |
| InChI | InChI=1S/C32H43ClN6O6/c1-20(30(40)34-13-15-43-17-18-44-16-14-35-31(41)45-32(3,4)5)27-29-38-37-21(2)39(29)26-12-11-24(42-6)19-25(26)28(36-27)22-7-9-23(33)10-8-22/h7-12,19-20,27,30,34,40H,13-18H2,1-6H3,(H,35,41)/t20-,27+,30?/m1/s1 |
| InChIKey | HJSITSFAWUJXOC-XHTVWAJZSA-N |
| XLogP | 4.23 |
| TPSA | 141.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.19 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|