C23H25N3S — CID 166919642
N-methyl-5-[(E)-4-[6-(3-methylpentyl)-1,3-benzothiazol-2-yl]but-3-en-1-ynyl]pyridin-2-amine (PubChem CID 166919642) has the molecular formula C23H25N3S and a molecular weight of 375.54 g/mol. Its IUPAC name is N-methyl-5-[(E)-4-[6-(3-methylpentyl)-1,3-benzothiazol-2-yl]but-3-en-1-ynyl]pyridin-2-amine.
| Compound Name | N-methyl-5-[(E)-4-[6-(3-methylpentyl)-1,3-benzothiazol-2-yl]but-3-en-1-ynyl]pyridin-2-amine |
|---|---|
| PubChem CID | 166919642 |
| Molecular Formula | C23H25N3S |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | N-methyl-5-[(E)-4-[6-(3-methylpentyl)-1,3-benzothiazol-2-yl]but-3-en-1-ynyl]pyridin-2-amine |
| SMILES | CCC(C)CCc1ccc2nc(/C=C/C#Cc3ccc(NC)nc3)sc2c1 |
| InChI | InChI=1S/C23H25N3S/c1-4-17(2)9-10-18-11-13-20-21(15-18)27-23(26-20)8-6-5-7-19-12-14-22(24-3)25-16-19/h6,8,11-17H,4,9-10H2,1-3H3,(H,24,25)/b8-6+ |
| InChIKey | VNSVQBCRTQOXEO-SOFGYWHQSA-N |
| XLogP | 5.78 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|