C18H15N3OS — CID 123478510
2-[4-[6-(dimethylamino)-3-pyridinyl]but-1-en-3-ynyl]-1,3-benzothiazol-6-ol (PubChem CID 123478510) has the molecular formula C18H15N3OS and a molecular weight of 321.41 g/mol. Its IUPAC name is 2-[4-[6-(dimethylamino)-3-pyridinyl]but-1-en-3-ynyl]-1,3-benzothiazol-6-ol.
| Compound Name | 2-[4-[6-(dimethylamino)-3-pyridinyl]but-1-en-3-ynyl]-1,3-benzothiazol-6-ol |
|---|---|
| PubChem CID | 123478510 |
| Molecular Formula | C18H15N3OS |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 2-[4-[6-(dimethylamino)-3-pyridinyl]but-1-en-3-ynyl]-1,3-benzothiazol-6-ol |
| SMILES | CN(C)c1ccc(C#CC=Cc2nc3ccc(O)cc3s2)cn1 |
| InChI | InChI=1S/C18H15N3OS/c1-21(2)17-10-7-13(12-19-17)5-3-4-6-18-20-15-9-8-14(22)11-16(15)23-18/h4,6-12,22H,1-2H3 |
| InChIKey | WCBXHMCICQRLGD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|