C10H11N3OS — CID 91992761
N'-(6-hydroxy-1,3-benzothiazol-2-yl)-N,N-dimethylmethanimidamide (PubChem CID 91992761) has the molecular formula C10H11N3OS and a molecular weight of 221.28 g/mol. Its IUPAC name is N'-(6-hydroxy-1,3-benzothiazol-2-yl)-N,N-dimethylmethanimidamide.
| Compound Name | N'-(6-hydroxy-1,3-benzothiazol-2-yl)-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 91992761 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | N'-(6-hydroxy-1,3-benzothiazol-2-yl)-N,N-dimethylmethanimidamide |
| SMILES | CN(C)C=Nc1nc2ccc(O)cc2s1 |
| InChI | InChI=1S/C10H11N3OS/c1-13(2)6-11-10-12-8-4-3-7(14)5-9(8)15-10/h3-6,14H,1-2H3 |
| InChIKey | YFJJQIUNFRZYIL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|