C17H33NO2S — CID 166920142
(E,2S)-2-methyl-3-(2-morpholin-4-ylethoxy)dec-4-ene-1-thiol (PubChem CID 166920142) has the molecular formula C17H33NO2S and a molecular weight of 315.52 g/mol. Its IUPAC name is (E,2S)-2-methyl-3-(2-morpholin-4-ylethoxy)dec-4-ene-1-thiol.
| Compound Name | (E,2S)-2-methyl-3-(2-morpholin-4-ylethoxy)dec-4-ene-1-thiol |
|---|---|
| PubChem CID | 166920142 |
| Molecular Formula | C17H33NO2S |
| Molecular Weight | 315.52 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | (E,2S)-2-methyl-3-(2-morpholin-4-ylethoxy)dec-4-ene-1-thiol |
| SMILES | CCCCC/C=C/C(OCCN1CCOCC1)[C@H](C)CS |
| InChI | InChI=1S/C17H33NO2S/c1-3-4-5-6-7-8-17(16(2)15-21)20-14-11-18-9-12-19-13-10-18/h7-8,16-17,21H,3-6,9-15H2,1-2H3/b8-7+/t16-,17?/m1/s1 |
| InChIKey | LASKOSSAKNFDSA-POSLFEONSA-N |
| XLogP | 3.41 |
| TPSA | 21.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.52 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|