C31H36Cl3IN6O4 — CID 166921998
tert-butyl 4-[4,6,20-trichloro-3-iodo-15-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-11-oxa-8,14,16-triazatetracyclo[10.8.0.02,7.013,18]icosa-1(20),2(7),3,5,12,14,16,18-octaen-17-yl]piperazine-1-carboxylate (PubChem CID 166921998) has the molecular formula C31H36Cl3IN6O4 and a molecular weight of 789.93 g/mol. Its IUPAC name is tert-butyl 4-[4,6,20-trichloro-3-iodo-15-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-11-oxa-8,14,16-triazatetracyclo[10.8.0.02,7.013,18]icosa-1(20),2(7),3,5,12,14,16,18-octaen-17-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4,6,20-trichloro-3-iodo-15-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-11-oxa-8,14,16-triazatetracyclo[10.8.0.02,7.013,18]icosa-1(20),2(7),3,5,12,14,16,18-octaen-17-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 166921998 |
| Molecular Formula | C31H36Cl3IN6O4 |
| Molecular Weight | 789.93 g/mol |
| Exact Mass | 788.09 |
| IUPAC Name | tert-butyl 4-[4,6,20-trichloro-3-iodo-15-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-11-oxa-8,14,16-triazatetracyclo[10.8.0.02,7.013,18]icosa-1(20),2(7),3,5,12,14,16,18-octaen-17-yl]piperazine-1-carboxylate |
| SMILES | CN1CCC[C@H]1COc1nc(N2CCN(C(=O)OC(C)(C)C)CC2)c2cc(Cl)c3c(c2n1)OCCNc1c(Cl)cc(Cl)c(I)c1-3 |
| InChI | InChI=1S/C31H36Cl3IN6O4/c1-31(2,3)45-30(42)41-11-9-40(10-12-41)28-18-14-19(32)22-23-24(35)20(33)15-21(34)26(23)36-7-13-43-27(22)25(18)37-29(38-28)44-16-17-6-5-8-39(17)4/h14-15,17,36H,5-13,16H2,1-4H3/t17-/m0/s1 |
| InChIKey | PTJLBRBMDYCIFA-KRWDZBQOSA-N |
| XLogP | 7.20 |
| TPSA | 92.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.93 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|