C27H28Cl3FN6O3 — CID 163717796
1-[4-[4,6,20-trichloro-15-[2-(dimethylamino)ethoxy]-3-fluoro-11-oxa-8,14,16-triazatetracyclo[10.8.0.02,7.013,18]icosa-1(20),2(7),3,5,12,14,16,18-octaen-17-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 163717796) has the molecular formula C27H28Cl3FN6O3 and a molecular weight of 609.92 g/mol. Its IUPAC name is 1-[4-[4,6,20-trichloro-15-[2-(dimethylamino)ethoxy]-3-fluoro-11-oxa-8,14,16-triazatetracyclo[10.8.0.02,7.013,18]icosa-1(20),2(7),3,5,12,14,16,18-octaen-17-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[4,6,20-trichloro-15-[2-(dimethylamino)ethoxy]-3-fluoro-11-oxa-8,14,16-triazatetracyclo[10.8.0.02,7.013,18]icosa-1(20),2(7),3,5,12,14,16,18-octaen-17-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 163717796 |
| Molecular Formula | C27H28Cl3FN6O3 |
| Molecular Weight | 609.92 g/mol |
| Exact Mass | 608.13 |
| IUPAC Name | 1-[4-[4,6,20-trichloro-15-[2-(dimethylamino)ethoxy]-3-fluoro-11-oxa-8,14,16-triazatetracyclo[10.8.0.02,7.013,18]icosa-1(20),2(7),3,5,12,14,16,18-octaen-17-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2nc(OCCN(C)C)nc3c4c(c(Cl)cc23)-c2c(F)c(Cl)cc(Cl)c2NCCO4)CC1 |
| InChI | InChI=1S/C27H28Cl3FN6O3/c1-4-19(38)36-6-8-37(9-7-36)26-15-13-16(28)20-21-22(31)17(29)14-18(30)24(21)32-5-11-39-25(20)23(15)33-27(34-26)40-12-10-35(2)3/h4,13-14,32H,1,5-12H2,2-3H3 |
| InChIKey | KOWPKXSAPOOTFF-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.92 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|