C21H44NP — CID 166922136
4-[cyclobutyl(methyl)phosphanyl]-N,5,5,7-tetramethyl-N-propan-2-ylnonan-2-amine (PubChem CID 166922136) has the molecular formula C21H44NP and a molecular weight of 341.56 g/mol. Its IUPAC name is 4-[cyclobutyl(methyl)phosphanyl]-N,5,5,7-tetramethyl-N-propan-2-ylnonan-2-amine.
| Compound Name | 4-[cyclobutyl(methyl)phosphanyl]-N,5,5,7-tetramethyl-N-propan-2-ylnonan-2-amine |
|---|---|
| PubChem CID | 166922136 |
| Molecular Formula | C21H44NP |
| Molecular Weight | 341.56 g/mol |
| Exact Mass | 341.32 |
| IUPAC Name | 4-[cyclobutyl(methyl)phosphanyl]-N,5,5,7-tetramethyl-N-propan-2-ylnonan-2-amine |
| SMILES | CCC(C)CC(C)(C)C(CC(C)N(C)C(C)C)P(C)C1CCC1 |
| InChI | InChI=1S/C21H44NP/c1-10-17(4)15-21(6,7)20(23(9)19-12-11-13-19)14-18(5)22(8)16(2)3/h16-20H,10-15H2,1-9H3 |
| InChIKey | FYGPJTWGKWBKAI-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.56 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|