C16H27N3O — CID 166927191
(1R)-2-[2-(ethylamino)ethyl-methylamino]-1-[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]ethanol (PubChem CID 166927191) has the molecular formula C16H27N3O and a molecular weight of 277.41 g/mol. Its IUPAC name is (1R)-2-[2-(ethylamino)ethyl-methylamino]-1-[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]ethanol.
| Compound Name | (1R)-2-[2-(ethylamino)ethyl-methylamino]-1-[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]ethanol |
|---|---|
| PubChem CID | 166927191 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | (1R)-2-[2-(ethylamino)ethyl-methylamino]-1-[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]ethanol |
| SMILES | CCNCCN(C)C[C@@H](O)[C@@H]1Cc2ccccc2CN1 |
| InChI | InChI=1S/C16H27N3O/c1-3-17-8-9-19(2)12-16(20)15-10-13-6-4-5-7-14(13)11-18-15/h4-7,15-18,20H,3,8-12H2,1-2H3/t15-,16+/m0/s1 |
| InChIKey | BQPZLSZZKBKWIO-JKSUJKDBSA-N |
| XLogP | 0.60 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|