C21H20N4O3 — CID 166930620
(19S)-7-amino-10-ethyl-19-hydroxy-19-methyl-3,13,17-triazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione (PubChem CID 166930620) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is (19S)-7-amino-10-ethyl-19-hydroxy-19-methyl-3,13,17-triazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione.
| Compound Name | (19S)-7-amino-10-ethyl-19-hydroxy-19-methyl-3,13,17-triazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione |
|---|---|
| PubChem CID | 166930620 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | (19S)-7-amino-10-ethyl-19-hydroxy-19-methyl-3,13,17-triazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione |
| SMILES | CCc1c2c(nc3ccc(N)cc13)-c1cc3c(c(=O)n1C2)CNC(=O)[C@@]3(C)O |
| InChI | InChI=1S/C21H20N4O3/c1-3-11-12-6-10(22)4-5-16(12)24-18-14(11)9-25-17(18)7-15-13(19(25)26)8-23-20(27)21(15,2)28/h4-7,28H,3,8-9,22H2,1-2H3,(H,23,27)/t21-/m0/s1 |
| InChIKey | IFEFCSUFLXLISX-NRFANRHFSA-N |
| XLogP | 1.41 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|