C16H29N3 — CID 166934308
5-[3-(4-methylpiperidin-1-yl)azetidin-1-yl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole (PubChem CID 166934308) has the molecular formula C16H29N3 and a molecular weight of 263.43 g/mol. Its IUPAC name is 5-[3-(4-methylpiperidin-1-yl)azetidin-1-yl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole.
| Compound Name | 5-[3-(4-methylpiperidin-1-yl)azetidin-1-yl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 166934308 |
| Molecular Formula | C16H29N3 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.24 |
| IUPAC Name | 5-[3-(4-methylpiperidin-1-yl)azetidin-1-yl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole |
| SMILES | CC1CCN(C2CN(C3CC4CNCC4C3)C2)CC1 |
| InChI | InChI=1S/C16H29N3/c1-12-2-4-18(5-3-12)16-10-19(11-16)15-6-13-8-17-9-14(13)7-15/h12-17H,2-11H2,1H3 |
| InChIKey | LAPHQSYQOMDPRJ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |