About 1-azabicyclo[3.1.0]hexane;3-azabicyclo[3.1.0]hexane
1-azabicyclo[3.1.0]hexane;3-azabicyclo[3.1.0]hexane (PubChem CID 87765664) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 1-azabicyclo[3.1.0]hexane;3-azabicyclo[3.1.0]hexane.
Molecular Properties
| Compound Name | 1-azabicyclo[3.1.0]hexane;3-azabicyclo[3.1.0]hexane |
| PubChem CID | 87765664 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 1-azabicyclo[3.1.0]hexane;3-azabicyclo[3.1.0]hexane |
| SMILES | C1CC2CN2C1.C1NCC2CC12 |
| InChI | InChI=1S/2C5H9N/c1-4-2-6-3-5(1)4;1-2-5-4-6(5)3-1/h4-6H,1-3H2;5H,1-4H2 |
| InChIKey | ZYOKKAFSQUGOIB-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-azabicyclo[3.1.0]hexane;3-azabicyclo[3.1.0]hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azabicyclo[3.1.0]hexane;3-azabicyclo[3.1.0]hexane?
The IUPAC name of 1-azabicyclo[3.1.0]hexane;3-azabicyclo[3.1.0]hexane (CID 87765664) is 1-azabicyclo[3.1.0]hexane;3-azabicyclo[3.1.0]hexane.
What is the SMILES notation for 1-azabicyclo[3.1.0]hexane;3-azabicyclo[3.1.0]hexane?
The canonical SMILES for 1-azabicyclo[3.1.0]hexane;3-azabicyclo[3.1.0]hexane is C1CC2CN2C1.C1NCC2CC12.
What is the InChIKey of 1-azabicyclo[3.1.0]hexane;3-azabicyclo[3.1.0]hexane?
The InChIKey is ZYOKKAFSQUGOIB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H9N/c1-4-2-6-3-5(1)4;1-2-5-4-6(5)3-1/h4-6H,1-3H2;5H,1-4H2.
What are the key properties of 1-azabicyclo[3.1.0]hexane;3-azabicyclo[3.1.0]hexane?
1-azabicyclo[3.1.0]hexane;3-azabicyclo[3.1.0]hexane has a molecular weight of 166.27 g/mol, XLogP of 0.69, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azabicyclo[3.1.0]hexane;3-azabicyclo[3.1.0]hexane is sourced from PubChem (CID 87765664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).