C16H12Cl2N2O2 — CID 166935015
7-chloro-5-[2-(chloromethyl)phenyl]-3-hydroxy-1,3-dihydro-1,4-benzodiazepin-2-one (PubChem CID 166935015) has the molecular formula C16H12Cl2N2O2 and a molecular weight of 335.19 g/mol. Its IUPAC name is 7-chloro-5-[2-(chloromethyl)phenyl]-3-hydroxy-1,3-dihydro-1,4-benzodiazepin-2-one.
| Compound Name | 7-chloro-5-[2-(chloromethyl)phenyl]-3-hydroxy-1,3-dihydro-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 166935015 |
| Molecular Formula | C16H12Cl2N2O2 |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 7-chloro-5-[2-(chloromethyl)phenyl]-3-hydroxy-1,3-dihydro-1,4-benzodiazepin-2-one |
| SMILES | O=C1Nc2ccc(Cl)cc2C(c2ccccc2CCl)=NC1O |
| InChI | InChI=1S/C16H12Cl2N2O2/c17-8-9-3-1-2-4-11(9)14-12-7-10(18)5-6-13(12)19-15(21)16(22)20-14/h1-7,16,22H,8H2,(H,19,21) |
| InChIKey | BYLDSXTVISXRGT-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|