About Lorazepam acetate
Lorazepam acetate (PubChem CID 17836) has the molecular formula C17H12Cl2N2O3
and a molecular weight of 363.20 g/mol. Its IUPAC name is [7-chloro-5-(2-chlorophenyl)-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl] acetate.
Molecular Properties
| Compound Name | Lorazepam acetate |
| PubChem CID | 17836 |
| Molecular Formula | C17H12Cl2N2O3 |
| Molecular Weight | 363.20 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | [7-chloro-5-(2-chlorophenyl)-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl] acetate |
| SMILES | CC(=O)OC1C(=O)NC2=C(C=C(C=C2)Cl)C(=N1)C3=CC=CC=C3Cl |
| InChI | InChI=1S/C17H12Cl2N2O3/c1-9(22)24-17-16(23)20-14-7-6-10(18)8-12(14)15(21-17)11-4-2-3-5-13(11)19/h2-8,17H,1H3,(H,20,23) |
| InChIKey | CYDZMDOLVUBPNL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 67.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | 540 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.20 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze Lorazepam acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Lorazepam acetate?
The IUPAC name of Lorazepam acetate (CID 17836) is [7-chloro-5-(2-chlorophenyl)-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl] acetate.
What is the SMILES notation for Lorazepam acetate?
The canonical SMILES for Lorazepam acetate is CC(=O)OC1C(=O)NC2=C(C=C(C=C2)Cl)C(=N1)C3=CC=CC=C3Cl.
What is the InChIKey of Lorazepam acetate?
The InChIKey is CYDZMDOLVUBPNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12Cl2N2O3/c1-9(22)24-17-16(23)20-14-7-6-10(18)8-12(14)15(21-17)11-4-2-3-5-13(11)19/h2-8,17H,1H3,(H,20,23).
What are the key properties of Lorazepam acetate?
Lorazepam acetate has a molecular weight of 363.20 g/mol, XLogP of 3.00, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Lorazepam acetate is sourced from PubChem (CID 17836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).