C20H24N4O2S2 — CID 166937630
2-propylsulfanyl-5-(4-thiomorpholin-4-ylphenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 166937630) has the molecular formula C20H24N4O2S2 and a molecular weight of 416.57 g/mol. Its IUPAC name is 2-propylsulfanyl-5-(4-thiomorpholin-4-ylphenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 2-propylsulfanyl-5-(4-thiomorpholin-4-ylphenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 166937630 |
| Molecular Formula | C20H24N4O2S2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 2-propylsulfanyl-5-(4-thiomorpholin-4-ylphenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | CCCSc1nc2c(c(=O)[nH]1)C(c1ccc(N3CCSCC3)cc1)CC(=O)N2 |
| InChI | InChI=1S/C20H24N4O2S2/c1-2-9-28-20-22-18-17(19(26)23-20)15(12-16(25)21-18)13-3-5-14(6-4-13)24-7-10-27-11-8-24/h3-6,15H,2,7-12H2,1H3,(H2,21,22,23,25,26) |
| InChIKey | OGCIWALAICKKQF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|