C25H30O2 — CID 166940085
2-[(1R)-2,4-dimethylcyclohex-3-en-1-yl]propan-2-yl 2,2-diphenylacetate (PubChem CID 166940085) has the molecular formula C25H30O2 and a molecular weight of 362.51 g/mol. Its IUPAC name is 2-[(1R)-2,4-dimethylcyclohex-3-en-1-yl]propan-2-yl 2,2-diphenylacetate.
| Compound Name | 2-[(1R)-2,4-dimethylcyclohex-3-en-1-yl]propan-2-yl 2,2-diphenylacetate |
|---|---|
| PubChem CID | 166940085 |
| Molecular Formula | C25H30O2 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 2-[(1R)-2,4-dimethylcyclohex-3-en-1-yl]propan-2-yl 2,2-diphenylacetate |
| SMILES | CC1=CC(C)[C@H](C(C)(C)OC(=O)C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C25H30O2/c1-18-15-16-22(19(2)17-18)25(3,4)27-24(26)23(20-11-7-5-8-12-20)21-13-9-6-10-14-21/h5-14,17,19,22-23H,15-16H2,1-4H3/t19?,22-/m1/s1 |
| InChIKey | MNKJDFXPAHBCKV-AVKWCDSFSA-N |
| XLogP | 6.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|