C27H28N4O4 — CID 166943044
2,3-dimethoxy-6-[9-methyl-3-(4-methylpiperazine-1-carbonyl)pyrido[3,4-b]indol-1-yl]benzaldehyde (PubChem CID 166943044) has the molecular formula C27H28N4O4 and a molecular weight of 472.55 g/mol. Its IUPAC name is 2,3-dimethoxy-6-[9-methyl-3-(4-methylpiperazine-1-carbonyl)pyrido[3,4-b]indol-1-yl]benzaldehyde.
| Compound Name | 2,3-dimethoxy-6-[9-methyl-3-(4-methylpiperazine-1-carbonyl)pyrido[3,4-b]indol-1-yl]benzaldehyde |
|---|---|
| PubChem CID | 166943044 |
| Molecular Formula | C27H28N4O4 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 2,3-dimethoxy-6-[9-methyl-3-(4-methylpiperazine-1-carbonyl)pyrido[3,4-b]indol-1-yl]benzaldehyde |
| SMILES | COc1ccc(-c2nc(C(=O)N3CCN(C)CC3)cc3c4ccccc4n(C)c23)c(C=O)c1OC |
| InChI | InChI=1S/C27H28N4O4/c1-29-11-13-31(14-12-29)27(33)21-15-19-17-7-5-6-8-22(17)30(2)25(19)24(28-21)18-9-10-23(34-3)26(35-4)20(18)16-32/h5-10,15-16H,11-14H2,1-4H3 |
| InChIKey | FTFUIBRZOPLYIF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 76.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|