C22H31NO5S — CID 166944270
tert-butyl 2-[[(1E,5Z)-4-methylhepta-1,5-dienyl]sulfonyloxymethyl]-2,3-dihydroindole-1-carboxylate (PubChem CID 166944270) has the molecular formula C22H31NO5S and a molecular weight of 421.56 g/mol. Its IUPAC name is tert-butyl 2-[[(1E,5Z)-4-methylhepta-1,5-dienyl]sulfonyloxymethyl]-2,3-dihydroindole-1-carboxylate.
| Compound Name | tert-butyl 2-[[(1E,5Z)-4-methylhepta-1,5-dienyl]sulfonyloxymethyl]-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 166944270 |
| Molecular Formula | C22H31NO5S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | tert-butyl 2-[[(1E,5Z)-4-methylhepta-1,5-dienyl]sulfonyloxymethyl]-2,3-dihydroindole-1-carboxylate |
| SMILES | C/C=C\C(C)C/C=C/S(=O)(=O)OCC1Cc2ccccc2N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H31NO5S/c1-6-10-17(2)11-9-14-29(25,26)27-16-19-15-18-12-7-8-13-20(18)23(19)21(24)28-22(3,4)5/h6-10,12-14,17,19H,11,15-16H2,1-5H3/b10-6-,14-9+ |
| InChIKey | CZLHEMQSXXTBOS-QGHFCHCFSA-N |
| XLogP | 4.82 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|