About 8-hydroxy-9,9-dimethyl-1-oxo-2-phenyl-2-azaspiro[4.5]dec-6-ene-7-carbonitrile
8-hydroxy-9,9-dimethyl-1-oxo-2-phenyl-2-azaspiro[4.5]dec-6-ene-7-carbonitrile (PubChem CID 166945814) has the molecular formula C18H20N2O2
and a molecular weight of 296.37 g/mol. Its IUPAC name is 8-hydroxy-9,9-dimethyl-1-oxo-2-phenyl-2-azaspiro[4.5]dec-6-ene-7-carbonitrile.
Molecular Properties
| Compound Name | 8-hydroxy-9,9-dimethyl-1-oxo-2-phenyl-2-azaspiro[4.5]dec-6-ene-7-carbonitrile |
| PubChem CID | 166945814 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 8-hydroxy-9,9-dimethyl-1-oxo-2-phenyl-2-azaspiro[4.5]dec-6-ene-7-carbonitrile |
| SMILES | CC1(C)CC2(C=C(C#N)C1O)CCN(c1ccccc1)C2=O |
| InChI | InChI=1S/C18H20N2O2/c1-17(2)12-18(10-13(11-19)15(17)21)8-9-20(16(18)22)14-6-4-3-5-7-14/h3-7,10,15,21H,8-9,12H2,1-2H3 |
| InChIKey | PRIBJDAOBBOMFJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-hydroxy-9,9-dimethyl-1-oxo-2-phenyl-2-azaspiro[4.5]dec-6-ene-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-hydroxy-9,9-dimethyl-1-oxo-2-phenyl-2-azaspiro[4.5]dec-6-ene-7-carbonitrile?
The IUPAC name of 8-hydroxy-9,9-dimethyl-1-oxo-2-phenyl-2-azaspiro[4.5]dec-6-ene-7-carbonitrile (CID 166945814) is 8-hydroxy-9,9-dimethyl-1-oxo-2-phenyl-2-azaspiro[4.5]dec-6-ene-7-carbonitrile.
What is the SMILES notation for 8-hydroxy-9,9-dimethyl-1-oxo-2-phenyl-2-azaspiro[4.5]dec-6-ene-7-carbonitrile?
The canonical SMILES for 8-hydroxy-9,9-dimethyl-1-oxo-2-phenyl-2-azaspiro[4.5]dec-6-ene-7-carbonitrile is CC1(C)CC2(C=C(C#N)C1O)CCN(c1ccccc1)C2=O.
What is the InChIKey of 8-hydroxy-9,9-dimethyl-1-oxo-2-phenyl-2-azaspiro[4.5]dec-6-ene-7-carbonitrile?
The InChIKey is PRIBJDAOBBOMFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O2/c1-17(2)12-18(10-13(11-19)15(17)21)8-9-20(16(18)22)14-6-4-3-5-7-14/h3-7,10,15,21H,8-9,12H2,1-2H3.
What are the key properties of 8-hydroxy-9,9-dimethyl-1-oxo-2-phenyl-2-azaspiro[4.5]dec-6-ene-7-carbonitrile?
8-hydroxy-9,9-dimethyl-1-oxo-2-phenyl-2-azaspiro[4.5]dec-6-ene-7-carbonitrile has a molecular weight of 296.37 g/mol, XLogP of 2.65, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hydroxy-9,9-dimethyl-1-oxo-2-phenyl-2-azaspiro[4.5]dec-6-ene-7-carbonitrile is sourced from PubChem (CID 166945814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).